C25H26F3N5O3 — CID 155242314
3-[2-(2,2-difluoroethyl)-3-fluoroanilino]-2-[3-[[(2S)-morpholin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 155242314) has the molecular formula C25H26F3N5O3 and a molecular weight of 501.51 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethyl)-3-fluoroanilino]-2-[3-[[(2S)-morpholin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 3-[2-(2,2-difluoroethyl)-3-fluoroanilino]-2-[3-[[(2S)-morpholin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 155242314 |
| Molecular Formula | C25H26F3N5O3 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 3-[2-(2,2-difluoroethyl)-3-fluoroanilino]-2-[3-[[(2S)-morpholin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | O=C1NCCc2[nH]c(-c3ccncc3OC[C@@H]3CNCCO3)c(Nc3cccc(F)c3CC(F)F)c21 |
| InChI | InChI=1S/C25H26F3N5O3/c26-17-2-1-3-18(16(17)10-21(27)28)32-24-22-19(5-7-31-25(22)34)33-23(24)15-4-6-29-12-20(15)36-13-14-11-30-8-9-35-14/h1-4,6,12,14,21,30,32-33H,5,7-11,13H2,(H,31,34)/t14-/m0/s1 |
| InChIKey | GPMDZMXKQPDXNY-AWEZNQCLSA-N |
| XLogP | 3.42 |
| TPSA | 100.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |