About ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde
ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde (PubChem CID 155716388) has the molecular formula C17H29NO
and a molecular weight of 263.43 g/mol. Its IUPAC name is ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde |
| PubChem CID | 155716388 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde |
| SMILES | CC.CC1(c2ncccc2C=O)CC1.CCC(C)C |
| InChI | InChI=1S/C10H11NO.C5H12.C2H6/c1-10(4-5-10)9-8(7-12)3-2-6-11-9;1-4-5(2)3;1-2/h2-3,6-7H,4-5H2,1H3;5H,4H2,1-3H3;1-2H3 |
| InChIKey | WAVNMILOVOGLAN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde?
The IUPAC name of ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde (CID 155716388) is ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde.
What is the SMILES notation for ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde?
The canonical SMILES for ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde is CC.CC1(c2ncccc2C=O)CC1.CCC(C)C.
What is the InChIKey of ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde?
The InChIKey is WAVNMILOVOGLAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO.C5H12.C2H6/c1-10(4-5-10)9-8(7-12)3-2-6-11-9;1-4-5(2)3;1-2/h2-3,6-7H,4-5H2,1H3;5H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde?
ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde has a molecular weight of 263.43 g/mol, XLogP of 5.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylbutane;2-(1-methylcyclopropyl)pyridine-3-carbaldehyde is sourced from PubChem (CID 155716388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).