C23H20FN5O2S — CID 155718031
4-cyclopropyl-3-[4-fluoro-5-(2-methyl-1,2,4-triazol-3-yl)-2-pyrrol-1-ylanilino]sulfanylbenzoic acid (PubChem CID 155718031) has the molecular formula C23H20FN5O2S and a molecular weight of 449.51 g/mol. Its IUPAC name is 4-cyclopropyl-3-[4-fluoro-5-(2-methyl-1,2,4-triazol-3-yl)-2-pyrrol-1-ylanilino]sulfanylbenzoic acid.
| Compound Name | 4-cyclopropyl-3-[4-fluoro-5-(2-methyl-1,2,4-triazol-3-yl)-2-pyrrol-1-ylanilino]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 155718031 |
| Molecular Formula | C23H20FN5O2S |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 4-cyclopropyl-3-[4-fluoro-5-(2-methyl-1,2,4-triazol-3-yl)-2-pyrrol-1-ylanilino]sulfanylbenzoic acid |
| SMILES | Cn1ncnc1-c1cc(NSc2cc(C(=O)O)ccc2C2CC2)c(-n2cccc2)cc1F |
| InChI | InChI=1S/C23H20FN5O2S/c1-28-22(25-13-26-28)17-11-19(20(12-18(17)24)29-8-2-3-9-29)27-32-21-10-15(23(30)31)6-7-16(21)14-4-5-14/h2-3,6-14,27H,4-5H2,1H3,(H,30,31) |
| InChIKey | FEWUNIRDPMZOPZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_G(4)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|