C23H33ClFNOS — CID 155718331
5-chloro-2,3-dihydro-1H-indene;ethane;4-(2-fluoropropylsulfanyl)benzamide (PubChem CID 155718331) has the molecular formula C23H33ClFNOS and a molecular weight of 426.04 g/mol. Its IUPAC name is 5-chloro-2,3-dihydro-1H-indene;ethane;4-(2-fluoropropylsulfanyl)benzamide.
| Compound Name | 5-chloro-2,3-dihydro-1H-indene;ethane;4-(2-fluoropropylsulfanyl)benzamide |
|---|---|
| PubChem CID | 155718331 |
| Molecular Formula | C23H33ClFNOS |
| Molecular Weight | 426.04 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 5-chloro-2,3-dihydro-1H-indene;ethane;4-(2-fluoropropylsulfanyl)benzamide |
| SMILES | CC.CC.CC(F)CSc1ccc(C(N)=O)cc1.Clc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C10H12FNOS.C9H9Cl.2C2H6/c1-7(11)6-14-9-4-2-8(3-5-9)10(12)13;10-9-5-4-7-2-1-3-8(7)6-9;2*1-2/h2-5,7H,6H2,1H3,(H2,12,13);4-6H,1-3H2;2*1-2H3 |
| InChIKey | WJZMSGCWPKZQMK-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.04 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |