C18H25FN2O3S — CID 155718520
methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanimidate (PubChem CID 155718520) has the molecular formula C18H25FN2O3S and a molecular weight of 368.47 g/mol. Its IUPAC name is methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanimidate.
| Compound Name | methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanimidate |
|---|---|
| PubChem CID | 155718520 |
| Molecular Formula | C18H25FN2O3S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanimidate |
| SMILES | C=C(/N=C(\OC)C(CSC)NC(=O)OC(C)(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C18H25FN2O3S/c1-12(13-8-7-9-14(19)10-13)20-16(23-5)15(11-25-6)21-17(22)24-18(2,3)4/h7-10,15H,1,11H2,2-6H3,(H,21,22)/b20-16- |
| InChIKey | ISAAFWDTNWVDCL-SILNSSARSA-N |
| XLogP | 4.10 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|