C17H23FN2O3 — CID 155718441
methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate (PubChem CID 155718441) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate.
| Compound Name | methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate |
|---|---|
| PubChem CID | 155718441 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate |
| SMILES | C=C(/N=C(\OC)C(C)NC(=O)OC(C)(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C17H23FN2O3/c1-11(13-8-7-9-14(18)10-13)19-15(22-6)12(2)20-16(21)23-17(3,4)5/h7-10,12H,1H2,2-6H3,(H,20,21)/b19-15- |
| InChIKey | MGUJYIMPHYWZCY-CYVLTUHYSA-N |
| XLogP | 3.75 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|