C21H28FN3O2 — CID 155718433
methyl 2-[[(E)-2,5-dimethyl-4-methyliminohex-2-enoyl]amino]-N-[1-(3-fluorophenyl)ethenyl]propanimidate (PubChem CID 155718433) has the molecular formula C21H28FN3O2 and a molecular weight of 373.47 g/mol. Its IUPAC name is methyl 2-[[(E)-2,5-dimethyl-4-methyliminohex-2-enoyl]amino]-N-[1-(3-fluorophenyl)ethenyl]propanimidate.
| Compound Name | methyl 2-[[(E)-2,5-dimethyl-4-methyliminohex-2-enoyl]amino]-N-[1-(3-fluorophenyl)ethenyl]propanimidate |
|---|---|
| PubChem CID | 155718433 |
| Molecular Formula | C21H28FN3O2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | methyl 2-[[(E)-2,5-dimethyl-4-methyliminohex-2-enoyl]amino]-N-[1-(3-fluorophenyl)ethenyl]propanimidate |
| SMILES | C=C(/N=C(\OC)C(C)NC(=O)/C(C)=C/C(=N/C)C(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C21H28FN3O2/c1-13(2)19(23-6)11-14(3)20(26)24-16(5)21(27-7)25-15(4)17-9-8-10-18(22)12-17/h8-13,16H,4H2,1-3,5-7H3,(H,24,26)/b14-11+,23-19-,25-21- |
| InChIKey | DTRYAHZZUPSNLK-PLNJTBCJSA-N |
| XLogP | 4.02 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|