C24H34F3N4O4P — CID 155718479
formaldehyde;methyl 2-[[(Z)-4-amino-5,5-difluoro-2-methylimino-5-phosphanylpent-3-enoyl]amino]-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]pentanimidate (PubChem CID 155718479) has the molecular formula C24H34F3N4O4P and a molecular weight of 530.53 g/mol. Its IUPAC name is formaldehyde;methyl 2-[[(Z)-4-amino-5,5-difluoro-2-methylimino-5-phosphanylpent-3-enoyl]amino]-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]pentanimidate.
| Compound Name | formaldehyde;methyl 2-[[(Z)-4-amino-5,5-difluoro-2-methylimino-5-phosphanylpent-3-enoyl]amino]-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]pentanimidate |
|---|---|
| PubChem CID | 155718479 |
| Molecular Formula | C24H34F3N4O4P |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | formaldehyde;methyl 2-[[(Z)-4-amino-5,5-difluoro-2-methylimino-5-phosphanylpent-3-enoyl]amino]-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]pentanimidate |
| SMILES | C=O.C=O.CCCC(NC(=O)C(/C=C(\N)C(F)(F)P)=N\C)/C(=N/C(=C(C)C)c1cccc(F)c1)OC |
| InChI | InChI=1S/C22H30F3N4O2P.2CH2O/c1-6-8-16(28-20(30)17(27-4)12-18(26)22(24,25)32)21(31-5)29-19(13(2)3)14-9-7-10-15(23)11-14;2*1-2/h7,9-12,16H,6,8,26,32H2,1-5H3,(H,28,30);2*1H2/b18-12-,27-17-,29-21-;; |
| InChIKey | SKNFIXQFEFYXCT-HMDOUBEJSA-N |
| XLogP | 3.92 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|