C27H40F3N3O2 — CID 155718602
(E)-5,5-difluoro-N-[2-[3-[(E)-1-(3-fluorophenyl)prop-1-enyl]iminopent-4-enoxy]ethyl]-4-imino-2-propylhex-2-enamide;ethane;molecular hydrogen (PubChem CID 155718602) has the molecular formula C27H40F3N3O2 and a molecular weight of 495.63 g/mol. Its IUPAC name is (E)-5,5-difluoro-N-[2-[3-[(E)-1-(3-fluorophenyl)prop-1-enyl]iminopent-4-enoxy]ethyl]-4-imino-2-propylhex-2-enamide;ethane;molecular hydrogen.
| Compound Name | (E)-5,5-difluoro-N-[2-[3-[(E)-1-(3-fluorophenyl)prop-1-enyl]iminopent-4-enoxy]ethyl]-4-imino-2-propylhex-2-enamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 155718602 |
| Molecular Formula | C27H40F3N3O2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | (E)-5,5-difluoro-N-[2-[3-[(E)-1-(3-fluorophenyl)prop-1-enyl]iminopent-4-enoxy]ethyl]-4-imino-2-propylhex-2-enamide;ethane;molecular hydrogen |
| SMILES | CC.[H]/N=C(/C=C(\CCC)C(=O)NCCOCC/C(C=C)=N/C(=C/C)c1cccc(F)c1)C(C)(F)F.[H][H] |
| InChI | InChI=1S/C25H32F3N3O2.C2H6.H2/c1-5-9-19(17-23(29)25(4,27)28)24(32)30-13-15-33-14-12-21(6-2)31-22(7-3)18-10-8-11-20(26)16-18;1-2;/h6-8,10-11,16-17,29H,2,5,9,12-15H2,1,3-4H3,(H,30,32);1-2H3;1H/b19-17+,22-7+,29-23-,31-21+;; |
| InChIKey | WJASGLPWJTWDBZ-WEADBGEDSA-N |
| XLogP | 7.01 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|