C18H26FN3O3S — CID 155718645
methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[methyl(sulfanyl)amino]propanimidate (PubChem CID 155718645) has the molecular formula C18H26FN3O3S and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[methyl(sulfanyl)amino]propanimidate.
| Compound Name | methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[methyl(sulfanyl)amino]propanimidate |
|---|---|
| PubChem CID | 155718645 |
| Molecular Formula | C18H26FN3O3S |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | methyl N-[1-(3-fluorophenyl)ethenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[methyl(sulfanyl)amino]propanimidate |
| SMILES | C=C(/N=C(\OC)C(CN(C)S)NC(=O)OC(C)(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C18H26FN3O3S/c1-12(13-8-7-9-14(19)10-13)20-16(24-6)15(11-22(5)26)21-17(23)25-18(2,3)4/h7-10,15,26H,1,11H2,2-6H3,(H,21,23)/b20-16- |
| InChIKey | BRJWSSHWDBZWNO-SILNSSARSA-N |
| XLogP | 3.51 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|