C34H69NO4S — CID 155720071
1-sulfanylpentadecan-7-yl 8-[1,3-dihydroxypropan-2-yl(octyl)amino]octanoate (PubChem CID 155720071) has the molecular formula C34H69NO4S and a molecular weight of 588.00 g/mol. Its IUPAC name is 1-sulfanylpentadecan-7-yl 8-[1,3-dihydroxypropan-2-yl(octyl)amino]octanoate.
| Compound Name | 1-sulfanylpentadecan-7-yl 8-[1,3-dihydroxypropan-2-yl(octyl)amino]octanoate |
|---|---|
| PubChem CID | 155720071 |
| Molecular Formula | C34H69NO4S |
| Molecular Weight | 588.00 g/mol |
| Exact Mass | 587.49 |
| IUPAC Name | 1-sulfanylpentadecan-7-yl 8-[1,3-dihydroxypropan-2-yl(octyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCS)OC(=O)CCCCCCCN(CCCCCCCC)C(CO)CO |
| InChI | InChI=1S/C34H69NO4S/c1-3-5-7-9-12-18-24-33(25-19-14-17-23-29-40)39-34(38)26-20-13-11-16-22-28-35(32(30-36)31-37)27-21-15-10-8-6-4-2/h32-33,36-37,40H,3-31H2,1-2H3 |
| InChIKey | MINFVJLDFGESGB-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.00 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|