About 1-(2,3-dimethylcyclopentyl)-N-methylmethanamine;ethane
1-(2,3-dimethylcyclopentyl)-N-methylmethanamine;ethane (PubChem CID 155722223) has the molecular formula C11H25N
and a molecular weight of 171.33 g/mol. Its IUPAC name is 1-(2,3-dimethylcyclopentyl)-N-methylmethanamine;ethane.
Analyze 1-(2,3-dimethylcyclopentyl)-N-methylmethanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dimethylcyclopentyl)-N-methylmethanamine;ethane?
The IUPAC name of 1-(2,3-dimethylcyclopentyl)-N-methylmethanamine;ethane (CID 155722223) is 1-(2,3-dimethylcyclopentyl)-N-methylmethanamine;ethane.
What is the SMILES notation for 1-(2,3-dimethylcyclopentyl)-N-methylmethanamine;ethane?
The canonical SMILES for 1-(2,3-dimethylcyclopentyl)-N-methylmethanamine;ethane is CC.CNCC1CCC(C)C1C.
What is the InChIKey of 1-(2,3-dimethylcyclopentyl)-N-methylmethanamine;ethane?
The InChIKey is GGHWSKDPNLZLGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C2H6/c1-7-4-5-9(6-10-3)8(7)2;1-2/h7-10H,4-6H2,1-3H3;1-2H3.
What are the key properties of 1-(2,3-dimethylcyclopentyl)-N-methylmethanamine;ethane?
1-(2,3-dimethylcyclopentyl)-N-methylmethanamine;ethane has a molecular weight of 171.33 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dimethylcyclopentyl)-N-methylmethanamine;ethane is sourced from PubChem (CID 155722223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).