C12H24IN — CID 134524444
1-[(2R)-2,3-dimethylcyclooctyl]-N-(iodomethyl)methanamine (PubChem CID 134524444) has the molecular formula C12H24IN and a molecular weight of 309.24 g/mol. Its IUPAC name is 1-[(2R)-2,3-dimethylcyclooctyl]-N-(iodomethyl)methanamine.
| Compound Name | 1-[(2R)-2,3-dimethylcyclooctyl]-N-(iodomethyl)methanamine |
|---|---|
| PubChem CID | 134524444 |
| Molecular Formula | C12H24IN |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-[(2R)-2,3-dimethylcyclooctyl]-N-(iodomethyl)methanamine |
| SMILES | CC1CCCCCC(CNCI)[C@@H]1C |
| InChI | InChI=1S/C12H24IN/c1-10-6-4-3-5-7-12(11(10)2)8-14-9-13/h10-12,14H,3-9H2,1-2H3/t10?,11-,12?/m1/s1 |
| InChIKey | NZRIWYPMQKDJOZ-MOENNCHZSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|