C31H32F2O — CID 155723467
(Z)-3-[3-[3-[3-(3,4-diethyl-5-fluorophenyl)-2-fluorophenyl]-2-methylphenyl]prop-1-en-2-yl]pent-3-en-2-one (PubChem CID 155723467) has the molecular formula C31H32F2O and a molecular weight of 458.59 g/mol. Its IUPAC name is (Z)-3-[3-[3-[3-(3,4-diethyl-5-fluorophenyl)-2-fluorophenyl]-2-methylphenyl]prop-1-en-2-yl]pent-3-en-2-one.
| Compound Name | (Z)-3-[3-[3-[3-(3,4-diethyl-5-fluorophenyl)-2-fluorophenyl]-2-methylphenyl]prop-1-en-2-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 155723467 |
| Molecular Formula | C31H32F2O |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (Z)-3-[3-[3-[3-(3,4-diethyl-5-fluorophenyl)-2-fluorophenyl]-2-methylphenyl]prop-1-en-2-yl]pent-3-en-2-one |
| SMILES | C=C(Cc1cccc(-c2cccc(-c3cc(F)c(CC)c(CC)c3)c2F)c1C)/C(=C/C)C(C)=O |
| InChI | InChI=1S/C31H32F2O/c1-7-22-17-24(18-30(32)26(22)9-3)28-14-11-15-29(31(28)33)27-13-10-12-23(20(27)5)16-19(4)25(8-2)21(6)34/h8,10-15,17-18H,4,7,9,16H2,1-3,5-6H3/b25-8- |
| InChIKey | OMSAGWDFWMTPIN-JAHAZDFLSA-N |
| XLogP | 8.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|