C16H19BN3ORb — CID 155724278
10-hydroxy-12-(1-methanidyl-3-methylpiperidin-4-yl)-5,7-diaza-10-boratricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene;rubidium(1+) (PubChem CID 155724278) has the molecular formula C16H19BN3ORb and a molecular weight of 365.63 g/mol. Its IUPAC name is 10-hydroxy-12-(1-methanidyl-3-methylpiperidin-4-yl)-5,7-diaza-10-boratricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene;rubidium(1+).
| Compound Name | 10-hydroxy-12-(1-methanidyl-3-methylpiperidin-4-yl)-5,7-diaza-10-boratricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene;rubidium(1+) |
|---|---|
| PubChem CID | 155724278 |
| Molecular Formula | C16H19BN3ORb |
| Molecular Weight | 365.63 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 10-hydroxy-12-(1-methanidyl-3-methylpiperidin-4-yl)-5,7-diaza-10-boratricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene;rubidium(1+) |
| SMILES | [CH2-]N1CCC(C2=CB(O)c3cnc4[nH]ccc4c32)C(C)C1.[Rb+] |
| InChI | InChI=1S/C16H19BN3O.Rb/c1-10-9-20(2)6-4-11(10)13-7-17(21)14-8-19-16-12(15(13)14)3-5-18-16;/h3,5,7-8,10-11,21H,2,4,6,9H2,1H3,(H,18,19);/q-1;+1 |
| InChIKey | GLMOEBGDTIRJPT-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.63 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|