C17H23BN4O2S — CID 159143019
3-(10-hydroxy-5,7,11-triaza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)-N-(methylidene-oxo-propyl-λ6-sulfanyl)cyclobutan-1-amine (PubChem CID 159143019) has the molecular formula C17H23BN4O2S and a molecular weight of 358.28 g/mol. Its IUPAC name is 3-(10-hydroxy-5,7,11-triaza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)-N-(methylidene-oxo-propyl-λ6-sulfanyl)cyclobutan-1-amine.
| Compound Name | 3-(10-hydroxy-5,7,11-triaza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)-N-(methylidene-oxo-propyl-λ6-sulfanyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 159143019 |
| Molecular Formula | C17H23BN4O2S |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 3-(10-hydroxy-5,7,11-triaza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)-N-(methylidene-oxo-propyl-λ6-sulfanyl)cyclobutan-1-amine |
| SMILES | C=S(=O)(CCC)NC1CC(C2=CNB(O)c3cnc4[nH]ccc4c32)C1 |
| InChI | InChI=1S/C17H23BN4O2S/c1-3-6-25(2,24)22-12-7-11(8-12)14-9-21-18(23)15-10-20-17-13(16(14)15)4-5-19-17/h4-5,9-12,21,23H,2-3,6-8H2,1H3,(H,19,20)(H,22,24) |
| InChIKey | OKZLJSPSGZKVEU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|