C18H24BN3O4S — CID 156713720
CID 156713720 (PubChem CID 156713720) has the molecular formula C18H24BN3O4S and a molecular weight of 389.29 g/mol.
| Compound Name | CID 156713720 |
|---|---|
| PubChem CID | 156713720 |
| Molecular Formula | C18H24BN3O4S |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | — |
| SMILES | CCCS(=O)(=O)N1CCC2(C1)CC1(OB(O)c3cnc4[nH]ccc4c31)C2C |
| InChI | InChI=1S/C18H24BN3O4S/c1-3-8-27(24,25)22-7-5-17(11-22)10-18(12(17)2)15-13-4-6-20-16(13)21-9-14(15)19(23)26-18/h4,6,9,12,23H,3,5,7-8,10-11H2,1-2H3,(H,20,21) |
| InChIKey | KARRGCBXEQEBMH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|