C17H23BN2O2 — CID 156713716
1',1'-diethyl-5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-cyclohexane] (PubChem CID 156713716) has the molecular formula C17H23BN2O2 and a molecular weight of 298.19 g/mol. Its IUPAC name is 1',1'-diethyl-5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-cyclohexane].
| Compound Name | 1',1'-diethyl-5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-cyclohexane] |
|---|---|
| PubChem CID | 156713716 |
| Molecular Formula | C17H23BN2O2 |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 1',1'-diethyl-5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-cyclohexane] |
| SMILES | CCC1(CC)CCC2(CC1)OB(O)c1cnc3[nH]ccc3c12 |
| InChI | InChI=1S/C17H23BN2O2/c1-3-16(4-2)6-8-17(9-7-16)14-12-5-10-19-15(12)20-11-13(14)18(21)22-17/h5,10-11,21H,3-4,6-9H2,1-2H3,(H,19,20) |
| InChIKey | CUMJDSKDCSATIP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|