C16H20BN3O4S — CID 156713725
CID 156713725 (PubChem CID 156713725) has the molecular formula C16H20BN3O4S and a molecular weight of 361.23 g/mol.
| Compound Name | CID 156713725 |
|---|---|
| PubChem CID | 156713725 |
| Molecular Formula | C16H20BN3O4S |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)N1CCC2(CC1)CC1(C2)OB(O)c2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C16H20BN3O4S/c1-25(22,23)20-6-3-15(4-7-20)9-16(10-15)13-11-2-5-18-14(11)19-8-12(13)17(21)24-16/h2,5,8,21H,3-4,6-7,9-10H2,1H3,(H,18,19) |
| InChIKey | LODFDOKFJVRYJQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|