C16H19BN2O2 — CID 156713665
CID 156713665 (PubChem CID 156713665) has the molecular formula C16H19BN2O2 and a molecular weight of 282.15 g/mol.
| Compound Name | CID 156713665 |
|---|---|
| PubChem CID | 156713665 |
| Molecular Formula | C16H19BN2O2 |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | — |
| SMILES | CC1CCC2(C1)CC1(C2)OB(O)c2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C16H19BN2O2/c1-10-2-4-15(6-10)8-16(9-15)13-11-3-5-18-14(11)19-7-12(13)17(20)21-16/h3,5,7,10,20H,2,4,6,8-9H2,1H3,(H,18,19) |
| InChIKey | PYDHEXXQNAHIJL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|