C19H25BN4O3 — CID 156713812
CID 156713812 (PubChem CID 156713812) has the molecular formula C19H25BN4O3 and a molecular weight of 368.25 g/mol.
| Compound Name | CID 156713812 |
|---|---|
| PubChem CID | 156713812 |
| Molecular Formula | C19H25BN4O3 |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | — |
| SMILES | CC(C)NC(=O)N1CC2(CCC3(CC2)OB(O)c2cnc4[nH]ccc4c23)C1 |
| InChI | InChI=1S/C19H25BN4O3/c1-12(2)23-17(25)24-10-18(11-24)4-6-19(7-5-18)15-13-3-8-21-16(13)22-9-14(15)20(26)27-19/h3,8-9,12,26H,4-7,10-11H2,1-2H3,(H,21,22)(H,23,25) |
| InChIKey | KJVYIJUSLWLYQP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|