C19H22BF3N4O3 — CID 156713710
CID 156713710 (PubChem CID 156713710) has the molecular formula C19H22BF3N4O3 and a molecular weight of 422.22 g/mol.
| Compound Name | CID 156713710 |
|---|---|
| PubChem CID | 156713710 |
| Molecular Formula | C19H22BF3N4O3 |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | — |
| SMILES | CC1C2(CCN(C(=O)NCC(F)(F)F)CC2)CC12OB(O)c1cnc3[nH]ccc3c12 |
| InChI | InChI=1S/C19H22BF3N4O3/c1-11-17(3-6-27(7-4-17)16(28)26-10-19(21,22)23)9-18(11)14-12-2-5-24-15(12)25-8-13(14)20(29)30-18/h2,5,8,11,29H,3-4,6-7,9-10H2,1H3,(H,24,25)(H,26,28) |
| InChIKey | YGAXECZZPASRLF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|