C23H26BN3O4S — CID 156713645
CID 156713645 (PubChem CID 156713645) has the molecular formula C23H26BN3O4S and a molecular weight of 451.36 g/mol.
| Compound Name | CID 156713645 |
|---|---|
| PubChem CID | 156713645 |
| Molecular Formula | C23H26BN3O4S |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3(CC2)CC2(OB(O)c4cnc5[nH]ccc5c42)C3C)cc1 |
| InChI | InChI=1S/C23H26BN3O4S/c1-15-3-5-17(6-4-15)32(29,30)27-11-8-22(9-12-27)14-23(16(22)2)20-18-7-10-25-21(18)26-13-19(20)24(28)31-23/h3-7,10,13,16,28H,8-9,11-12,14H2,1-2H3,(H,25,26) |
| InChIKey | QACCPBRIZVNGKX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|