C18H18BN3O2S — CID 156713799
5-hydroxy-1'-phenylsulfanylspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine] (PubChem CID 156713799) has the molecular formula C18H18BN3O2S and a molecular weight of 351.24 g/mol. Its IUPAC name is 5-hydroxy-1'-phenylsulfanylspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine].
| Compound Name | 5-hydroxy-1'-phenylsulfanylspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine] |
|---|---|
| PubChem CID | 156713799 |
| Molecular Formula | C18H18BN3O2S |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 5-hydroxy-1'-phenylsulfanylspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine] |
| SMILES | OB1OC2(CCN(Sc3ccccc3)CC2)c2c1cnc1[nH]ccc21 |
| InChI | InChI=1S/C18H18BN3O2S/c23-19-15-12-21-17-14(6-9-20-17)16(15)18(24-19)7-10-22(11-8-18)25-13-4-2-1-3-5-13/h1-6,9,12,23H,7-8,10-11H2,(H,20,21) |
| InChIKey | GNHIYAUXNCHOLN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|