C15H21BN4O2S — CID 156713806
N-[2-(5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine]-1'-yl)ethylsulfanyl]methanamine (PubChem CID 156713806) has the molecular formula C15H21BN4O2S and a molecular weight of 332.24 g/mol. Its IUPAC name is N-[2-(5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine]-1'-yl)ethylsulfanyl]methanamine.
| Compound Name | N-[2-(5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine]-1'-yl)ethylsulfanyl]methanamine |
|---|---|
| PubChem CID | 156713806 |
| Molecular Formula | C15H21BN4O2S |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[2-(5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine]-1'-yl)ethylsulfanyl]methanamine |
| SMILES | CNSCCN1CCC2(CC1)OB(O)c1cnc3[nH]ccc3c12 |
| InChI | InChI=1S/C15H21BN4O2S/c1-17-23-9-8-20-6-3-15(4-7-20)13-11-2-5-18-14(11)19-10-12(13)16(21)22-15/h2,5,10,17,21H,3-4,6-9H2,1H3,(H,18,19) |
| InChIKey | YSCWSYJMZIEMEU-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 73.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|