C12H14BN3O2 — CID 156713660
5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine] (PubChem CID 156713660) has the molecular formula C12H14BN3O2 and a molecular weight of 243.07 g/mol. Its IUPAC name is 5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine].
| Compound Name | 5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine] |
|---|---|
| PubChem CID | 156713660 |
| Molecular Formula | C12H14BN3O2 |
| Molecular Weight | 243.07 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine] |
| SMILES | OB1OC2(CCNCC2)c2c1cnc1[nH]ccc21 |
| InChI | InChI=1S/C12H14BN3O2/c17-13-9-7-16-11-8(1-4-15-11)10(9)12(18-13)2-5-14-6-3-12/h1,4,7,14,17H,2-3,5-6H2,(H,15,16) |
| InChIKey | LIDPSIYXLDZAEC-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.07 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|