C18H20BF3N4O3 — CID 156713785
CID 156713785 (PubChem CID 156713785) has the molecular formula C18H20BF3N4O3 and a molecular weight of 408.19 g/mol.
| Compound Name | CID 156713785 |
|---|---|
| PubChem CID | 156713785 |
| Molecular Formula | C18H20BF3N4O3 |
| Molecular Weight | 408.19 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | — |
| SMILES | CC1C2(CCN(C(=O)NCC(F)(F)F)C2)CC12OB(O)c1cnc3[nH]ccc3c12 |
| InChI | InChI=1S/C18H20BF3N4O3/c1-10-16(3-5-26(9-16)15(27)25-8-18(20,21)22)7-17(10)13-11-2-4-23-14(11)24-6-12(13)19(28)29-17/h2,4,6,10,28H,3,5,7-9H2,1H3,(H,23,24)(H,25,27) |
| InChIKey | DJJLBBLROZTPIX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|