C20H18BN3O3 — CID 159389097
N-[3-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)cyclobutyl]benzamide (PubChem CID 159389097) has the molecular formula C20H18BN3O3 and a molecular weight of 359.19 g/mol. Its IUPAC name is N-[3-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)cyclobutyl]benzamide.
| Compound Name | N-[3-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)cyclobutyl]benzamide |
|---|---|
| PubChem CID | 159389097 |
| Molecular Formula | C20H18BN3O3 |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-[3-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)cyclobutyl]benzamide |
| SMILES | O=C(NC1CC(C2=CB(O)Oc3cnc4[nH]ccc4c32)C1)c1ccccc1 |
| InChI | InChI=1S/C20H18BN3O3/c25-20(12-4-2-1-3-5-12)24-14-8-13(9-14)16-10-21(26)27-17-11-23-19-15(18(16)17)6-7-22-19/h1-7,10-11,13-14,26H,8-9H2,(H,22,23)(H,24,25) |
| InChIKey | DGQMSGJHUUDRMD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|