C9H7BN2O2 — CID 155724236
11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaene (PubChem CID 155724236) has the molecular formula C9H7BN2O2 and a molecular weight of 185.98 g/mol. Its IUPAC name is 11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaene.
| Compound Name | 11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaene |
|---|---|
| PubChem CID | 155724236 |
| Molecular Formula | C9H7BN2O2 |
| Molecular Weight | 185.98 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaene |
| SMILES | OB1C=Cc2c(cnc3[nH]ccc23)O1 |
| InChI | InChI=1S/C9H7BN2O2/c13-10-3-1-6-7-2-4-11-9(7)12-5-8(6)14-10/h1-5,13H,(H,11,12) |
| InChIKey | KHJSVUKZZWTCQH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.98 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|