C18H23BN4O3 — CID 155724150
(4S)-N-ethyl-3-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)-4-methylpiperidine-1-carboxamide (PubChem CID 155724150) has the molecular formula C18H23BN4O3 and a molecular weight of 354.22 g/mol. Its IUPAC name is (4S)-N-ethyl-3-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)-4-methylpiperidine-1-carboxamide.
| Compound Name | (4S)-N-ethyl-3-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 155724150 |
| Molecular Formula | C18H23BN4O3 |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (4S)-N-ethyl-3-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)-4-methylpiperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CC[C@H](C)C(C2=CB(O)Oc3cnc4[nH]ccc4c32)C1 |
| InChI | InChI=1S/C18H23BN4O3/c1-3-20-18(24)23-7-5-11(2)14(10-23)13-8-19(25)26-15-9-22-17-12(16(13)15)4-6-21-17/h4,6,8-9,11,14,25H,3,5,7,10H2,1-2H3,(H,20,24)(H,21,22)/t11-,14?/m0/s1 |
| InChIKey | OPPAWMRMRYXPRR-ZSOXZCCMSA-N |
| XLogP | 2.05 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|