C19H20BN3O3 — CID 158722129
4-[4-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)cyclohexyl]-3-oxobutanenitrile (PubChem CID 158722129) has the molecular formula C19H20BN3O3 and a molecular weight of 349.20 g/mol. Its IUPAC name is 4-[4-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)cyclohexyl]-3-oxobutanenitrile.
| Compound Name | 4-[4-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)cyclohexyl]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 158722129 |
| Molecular Formula | C19H20BN3O3 |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 4-[4-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)cyclohexyl]-3-oxobutanenitrile |
| SMILES | N#CCC(=O)CC1CCC(C2=CB(O)Oc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C19H20BN3O3/c21-7-5-14(24)9-12-1-3-13(4-2-12)16-10-20(25)26-17-11-23-19-15(18(16)17)6-8-22-19/h6,8,10-13,25H,1-5,9H2,(H,22,23) |
| InChIKey | HZEBIIVFNYPVCA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|