C14H15BN2O2 — CID 159548452
13-cyclobutyl-11-hydroxy-8-methyl-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaene (PubChem CID 159548452) has the molecular formula C14H15BN2O2 and a molecular weight of 254.10 g/mol. Its IUPAC name is 13-cyclobutyl-11-hydroxy-8-methyl-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaene.
| Compound Name | 13-cyclobutyl-11-hydroxy-8-methyl-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaene |
|---|---|
| PubChem CID | 159548452 |
| Molecular Formula | C14H15BN2O2 |
| Molecular Weight | 254.10 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 13-cyclobutyl-11-hydroxy-8-methyl-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaene |
| SMILES | Cc1nc2[nH]ccc2c2c1OB(O)C=C2C1CCC1 |
| InChI | InChI=1S/C14H15BN2O2/c1-8-13-12(10-5-6-16-14(10)17-8)11(7-15(18)19-13)9-3-2-4-9/h5-7,9,18H,2-4H2,1H3,(H,16,17) |
| InChIKey | WMLISWISQSBOJQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.10 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|