C19H24BN3O3 — CID 155724202
1-[(3R,4S)-3-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)-4-methylpiperidin-1-yl]butan-1-one (PubChem CID 155724202) has the molecular formula C19H24BN3O3 and a molecular weight of 353.23 g/mol. Its IUPAC name is 1-[(3R,4S)-3-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)-4-methylpiperidin-1-yl]butan-1-one.
| Compound Name | 1-[(3R,4S)-3-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)-4-methylpiperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 155724202 |
| Molecular Formula | C19H24BN3O3 |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 1-[(3R,4S)-3-(11-hydroxy-10-oxa-5,7-diaza-11-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)-4-methylpiperidin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CC[C@H](C)[C@H](C2=CB(O)Oc3cnc4[nH]ccc4c32)C1 |
| InChI | InChI=1S/C19H24BN3O3/c1-3-4-17(24)23-8-6-12(2)15(11-23)14-9-20(25)26-16-10-22-19-13(18(14)16)5-7-21-19/h5,7,9-10,12,15,25H,3-4,6,8,11H2,1-2H3,(H,21,22)/t12-,15+/m0/s1 |
| InChIKey | MZQYTWPEATYYKT-SWLSCSKDSA-N |
| XLogP | 2.64 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|