C15H22BN5OS — CID 155724321
10-hydroxy-5,7,11,12-tetraza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaene;N-propylsulfanylcyclobutanamine (PubChem CID 155724321) has the molecular formula C15H22BN5OS and a molecular weight of 331.25 g/mol. Its IUPAC name is 10-hydroxy-5,7,11,12-tetraza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaene;N-propylsulfanylcyclobutanamine.
| Compound Name | 10-hydroxy-5,7,11,12-tetraza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaene;N-propylsulfanylcyclobutanamine |
|---|---|
| PubChem CID | 155724321 |
| Molecular Formula | C15H22BN5OS |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 10-hydroxy-5,7,11,12-tetraza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaene;N-propylsulfanylcyclobutanamine |
| SMILES | CCCSNC1CCC1.OB1NN=Cc2c1cnc1[nH]ccc21 |
| InChI | InChI=1S/C8H7BN4O.C7H15NS/c14-9-7-4-11-8-5(1-2-10-8)6(7)3-12-13-9;1-2-6-9-8-7-4-3-5-7/h1-4,13-14H,(H,10,11);7-8H,2-6H2,1H3 |
| InChIKey | GECJJQBFYRFBKT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|