C18H26ClNO4 — CID 155724616
azetidine;tert-butyl 4-(6-chloro-1,3-benzodioxol-5-yl)butanoate (PubChem CID 155724616) has the molecular formula C18H26ClNO4 and a molecular weight of 355.86 g/mol. Its IUPAC name is azetidine;tert-butyl 4-(6-chloro-1,3-benzodioxol-5-yl)butanoate.
| Compound Name | azetidine;tert-butyl 4-(6-chloro-1,3-benzodioxol-5-yl)butanoate |
|---|---|
| PubChem CID | 155724616 |
| Molecular Formula | C18H26ClNO4 |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | azetidine;tert-butyl 4-(6-chloro-1,3-benzodioxol-5-yl)butanoate |
| SMILES | C1CNC1.CC(C)(C)OC(=O)CCCc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C15H19ClO4.C3H7N/c1-15(2,3)20-14(17)6-4-5-10-7-12-13(8-11(10)16)19-9-18-12;1-2-4-3-1/h7-8H,4-6,9H2,1-3H3;4H,1-3H2 |
| InChIKey | PKCIMINXZNACSA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |