About CID 155725555
CID 155725555 (PubChem CID 155725555) has the molecular formula C10H21LrNO-2
and a molecular weight of 433.28 g/mol.
Molecular Properties
| Compound Name | CID 155725555 |
| PubChem CID | 155725555 |
| Molecular Formula | C10H21LrNO-2 |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | — |
| SMILES | C[C-]1CCNOC1C(C)(C)C.[CH3-].[Lr] |
| InChI | InChI=1S/C9H18NO.CH3.Lr/c1-7-5-6-10-11-8(7)9(2,3)4;;/h8,10H,5-6H2,1-4H3;1H3;/q2*-1; |
| InChIKey | BFAOIIBTCAFTQI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 155725555 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155725555?
The IUPAC name of CID 155725555 (CID 155725555) is not available.
What is the SMILES notation for CID 155725555?
The canonical SMILES for CID 155725555 is C[C-]1CCNOC1C(C)(C)C.[CH3-].[Lr].
What is the InChIKey of CID 155725555?
The InChIKey is BFAOIIBTCAFTQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18NO.CH3.Lr/c1-7-5-6-10-11-8(7)9(2,3)4;;/h8,10H,5-6H2,1-4H3;1H3;/q2*-1;.
What are the key properties of CID 155725555?
CID 155725555 has a molecular weight of 433.28 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155725555 is sourced from PubChem (CID 155725555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).