C12H23W- — CID 59770052
1,2-ditert-butyl-3-methylcyclopropane;tungsten (PubChem CID 59770052) has the molecular formula C12H23W- and a molecular weight of 351.16 g/mol. Its IUPAC name is 1,2-ditert-butyl-3-methylcyclopropane;tungsten.
| Compound Name | 1,2-ditert-butyl-3-methylcyclopropane;tungsten |
|---|---|
| PubChem CID | 59770052 |
| Molecular Formula | C12H23W- |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1,2-ditert-butyl-3-methylcyclopropane;tungsten |
| SMILES | C[C-]1C(C(C)(C)C)C1C(C)(C)C.[W] |
| InChI | InChI=1S/C12H23.W/c1-8-9(11(2,3)4)10(8)12(5,6)7;/h9-10H,1-7H3;/q-1; |
| InChIKey | YZWCWFBVCDTTFZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|