C7H12N2O3 — CID 155727062
2-amino-N-(3,4-dioxobutan-2-yl)-N-methylacetamide (PubChem CID 155727062) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is 2-amino-N-(3,4-dioxobutan-2-yl)-N-methylacetamide.
| Compound Name | 2-amino-N-(3,4-dioxobutan-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 155727062 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 2-amino-N-(3,4-dioxobutan-2-yl)-N-methylacetamide |
| SMILES | CC(C(=O)C=O)N(C)C(=O)CN |
| InChI | InChI=1S/C7H12N2O3/c1-5(6(11)4-10)9(2)7(12)3-8/h4-5H,3,8H2,1-2H3 |
| InChIKey | YUXZAUMTMVUUJA-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|