About 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine
3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine (PubChem CID 155727743) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine.
Molecular Properties
| Compound Name | 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine |
| PubChem CID | 155727743 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine |
| SMILES | CN1CCOCC1c1ccn2ccnc2c1 |
| InChI | InChI=1S/C12H15N3O/c1-14-6-7-16-9-11(14)10-2-4-15-5-3-13-12(15)8-10/h2-5,8,11H,6-7,9H2,1H3 |
| InChIKey | HASDIRYVNGSHGP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine?
The IUPAC name of 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine (CID 155727743) is 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine.
What is the SMILES notation for 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine?
The canonical SMILES for 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine is CN1CCOCC1c1ccn2ccnc2c1.
What is the InChIKey of 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine?
The InChIKey is HASDIRYVNGSHGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O/c1-14-6-7-16-9-11(14)10-2-4-15-5-3-13-12(15)8-10/h2-5,8,11H,6-7,9H2,1H3.
What are the key properties of 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine?
3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine has a molecular weight of 217.27 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine is sourced from PubChem (CID 155727743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).