C12H15N3O — CID 155727743
3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine (PubChem CID 155727743) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine.
| Compound Name | 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine |
|---|---|
| PubChem CID | 155727743 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-7-yl-4-methylmorpholine |
| SMILES | CN1CCOCC1c1ccn2ccnc2c1 |
| InChI | InChI=1S/C12H15N3O/c1-14-6-7-16-9-11(14)10-2-4-15-5-3-13-12(15)8-10/h2-5,8,11H,6-7,9H2,1H3 |
| InChIKey | HASDIRYVNGSHGP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |