C17H18N6O4 — CID 155730451
ethane;methyl 6-[4-(2-amino-3-nitro-4-pyridinyl)pyrazol-1-yl]pyridine-3-carboxylate (PubChem CID 155730451) has the molecular formula C17H18N6O4 and a molecular weight of 370.37 g/mol. Its IUPAC name is ethane;methyl 6-[4-(2-amino-3-nitro-4-pyridinyl)pyrazol-1-yl]pyridine-3-carboxylate.
| Compound Name | ethane;methyl 6-[4-(2-amino-3-nitro-4-pyridinyl)pyrazol-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 155730451 |
| Molecular Formula | C17H18N6O4 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | ethane;methyl 6-[4-(2-amino-3-nitro-4-pyridinyl)pyrazol-1-yl]pyridine-3-carboxylate |
| SMILES | CC.COC(=O)c1ccc(-n2cc(-c3ccnc(N)c3[N+](=O)[O-])cn2)nc1 |
| InChI | InChI=1S/C15H12N6O4.C2H6/c1-25-15(22)9-2-3-12(18-6-9)20-8-10(7-19-20)11-4-5-17-14(16)13(11)21(23)24;1-2/h2-8H,1H3,(H2,16,17);1-2H3 |
| InChIKey | FDEMYGXPPZJGRY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|