C24H23F6NO4 — CID 155730994
3-[3-[1-[1-[2,5-bis(trifluoromethyl)phenyl]ethyl]pyrrolidine-3-carbonyl]oxyphenyl]propanoic acid (PubChem CID 155730994) has the molecular formula C24H23F6NO4 and a molecular weight of 503.44 g/mol. Its IUPAC name is 3-[3-[1-[1-[2,5-bis(trifluoromethyl)phenyl]ethyl]pyrrolidine-3-carbonyl]oxyphenyl]propanoic acid.
| Compound Name | 3-[3-[1-[1-[2,5-bis(trifluoromethyl)phenyl]ethyl]pyrrolidine-3-carbonyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 155730994 |
| Molecular Formula | C24H23F6NO4 |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 3-[3-[1-[1-[2,5-bis(trifluoromethyl)phenyl]ethyl]pyrrolidine-3-carbonyl]oxyphenyl]propanoic acid |
| SMILES | CC(c1cc(C(F)(F)F)ccc1C(F)(F)F)N1CCC(C(=O)Oc2cccc(CCC(=O)O)c2)C1 |
| InChI | InChI=1S/C24H23F6NO4/c1-14(19-12-17(23(25,26)27)6-7-20(19)24(28,29)30)31-10-9-16(13-31)22(34)35-18-4-2-3-15(11-18)5-8-21(32)33/h2-4,6-7,11-12,14,16H,5,8-10,13H2,1H3,(H,32,33) |
| InChIKey | YBHUDQKEXBZUKJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|