C18H26FN3S — CID 155735778
[4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-1-(1-methylsulfanylethenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanamine (PubChem CID 155735778) has the molecular formula C18H26FN3S and a molecular weight of 335.49 g/mol. Its IUPAC name is [4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-1-(1-methylsulfanylethenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanamine.
| Compound Name | [4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-1-(1-methylsulfanylethenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanamine |
|---|---|
| PubChem CID | 155735778 |
| Molecular Formula | C18H26FN3S |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | [4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-1-(1-methylsulfanylethenyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanamine |
| SMILES | C=C(/C=C\CC(C)F)C1=C2CC(CN)CN2C(C(=C)SC)=NC1 |
| InChI | InChI=1S/C18H26FN3S/c1-12(6-5-7-13(2)19)16-10-21-18(14(3)23-4)22-11-15(9-20)8-17(16)22/h5-6,13,15H,1,3,7-11,20H2,2,4H3/b6-5- |
| InChIKey | WTJQXMPCIUIOAU-WAYWQWQTSA-N |
| XLogP | 3.67 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|