C21H30FN3S — CID 155735859
1-[4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]-N-methylmethanamine (PubChem CID 155735859) has the molecular formula C21H30FN3S and a molecular weight of 375.56 g/mol. Its IUPAC name is 1-[4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]-N-methylmethanamine.
| Compound Name | 1-[4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 155735859 |
| Molecular Formula | C21H30FN3S |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 1-[4-[(3Z)-6-fluorohepta-1,3-dien-2-yl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]-N-methylmethanamine |
| SMILES | C=C(/C=C\CC(C)F)C1=C2CC(CNC)CN2C(C(=C)S/C=C\C)=NC1 |
| InChI | InChI=1S/C21H30FN3S/c1-6-10-26-17(4)21-24-13-19(15(2)8-7-9-16(3)22)20-11-18(12-23-5)14-25(20)21/h6-8,10,16,18,23H,2,4,9,11-14H2,1,3,5H3/b8-7-,10-6- |
| InChIKey | MYKHTRVQGDMBSG-OYIUBJQVSA-N |
| XLogP | 4.83 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|