C27H42N2S — CID 155735901
4-[(3E,5Z)-8-methylnona-3,5-dien-4-yl]-6-pentyl-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine (PubChem CID 155735901) has the molecular formula C27H42N2S and a molecular weight of 426.71 g/mol. Its IUPAC name is 4-[(3E,5Z)-8-methylnona-3,5-dien-4-yl]-6-pentyl-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine.
| Compound Name | 4-[(3E,5Z)-8-methylnona-3,5-dien-4-yl]-6-pentyl-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 155735901 |
| Molecular Formula | C27H42N2S |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | 4-[(3E,5Z)-8-methylnona-3,5-dien-4-yl]-6-pentyl-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
| SMILES | C=C(S/C=C\C)C1=NCC(C(/C=C\CC(C)C)=C/CC)=C2CC(CCCCC)CN12 |
| InChI | InChI=1S/C27H42N2S/c1-7-10-11-15-23-18-26-25(24(13-8-2)16-12-14-21(4)5)19-28-27(29(26)20-23)22(6)30-17-9-3/h9,12-13,16-17,21,23H,6-8,10-11,14-15,18-20H2,1-5H3/b16-12-,17-9-,24-13+ |
| InChIKey | KQYZYMLDGJSBTG-RXVCFTMPSA-N |
| XLogP | 8.27 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|