C21H30N2S — CID 155735776
6-ethyl-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine (PubChem CID 155735776) has the molecular formula C21H30N2S and a molecular weight of 342.55 g/mol. Its IUPAC name is 6-ethyl-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine.
| Compound Name | 6-ethyl-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 155735776 |
| Molecular Formula | C21H30N2S |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 6-ethyl-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
| SMILES | C=C(S/C=C\C)C1=NCC(C(/C=C\C)=C/CC)=C2CC(CC)CN12 |
| InChI | InChI=1S/C21H30N2S/c1-6-10-18(11-7-2)19-14-22-21(16(5)24-12-8-3)23-15-17(9-4)13-20(19)23/h6,8,10-12,17H,5,7,9,13-15H2,1-4H3/b10-6-,12-8-,18-11+ |
| InChIKey | MEWQHIPEMYQNTL-AJDRSRKQSA-N |
| XLogP | 6.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|