C5H3F8K — CID 155749437
potassium 1,1,2,2,3,3,4,4-octafluoropentane (PubChem CID 155749437) has the molecular formula C5H3F8K and a molecular weight of 254.16 g/mol. Its IUPAC name is potassium 1,1,2,2,3,3,4,4-octafluoropentane.
| Compound Name | potassium 1,1,2,2,3,3,4,4-octafluoropentane |
|---|---|
| PubChem CID | 155749437 |
| Molecular Formula | C5H3F8K |
| Molecular Weight | 254.16 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | potassium 1,1,2,2,3,3,4,4-octafluoropentane |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)[C-](F)F.[K+] |
| InChI | InChI=1S/C5H3F8.K/c1-3(8,9)5(12,13)4(10,11)2(6)7;/h1H3;/q-1;+1 |
| InChIKey | YPXMHNVSFWRVEE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.16 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|