C27H48O — CID 155751174
methane;1-[(8R)-2,6,8,17-tetramethyl-16-tetracyclo[9.8.0.02,8.012,17]nonadecanyl]prop-2-en-1-ol (PubChem CID 155751174) has the molecular formula C27H48O and a molecular weight of 388.68 g/mol. Its IUPAC name is methane;1-[(8R)-2,6,8,17-tetramethyl-16-tetracyclo[9.8.0.02,8.012,17]nonadecanyl]prop-2-en-1-ol.
| Compound Name | methane;1-[(8R)-2,6,8,17-tetramethyl-16-tetracyclo[9.8.0.02,8.012,17]nonadecanyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 155751174 |
| Molecular Formula | C27H48O |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 388.37 |
| IUPAC Name | methane;1-[(8R)-2,6,8,17-tetramethyl-16-tetracyclo[9.8.0.02,8.012,17]nonadecanyl]prop-2-en-1-ol |
| SMILES | C.C=CC(O)C1CCCC2C3CC[C@]4(C)CC(C)CCCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H44O.CH4/c1-6-23(27)22-11-7-10-20-19-12-15-24(3)17-18(2)9-8-14-26(24,5)21(19)13-16-25(20,22)4;/h6,18-23,27H,1,7-17H2,2-5H3;1H4/t18?,19?,20?,21?,22?,23?,24-,25?,26?;/m1./s1 |
| InChIKey | IDQWFEMRUOBXNA-ITAPJSDTSA-N |
| XLogP | 7.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|