C25H44O — CID 155751320
3-[(6aR)-4-ethyl-3,6a,8,11a-tetramethyl-1,2,4,4a,5,6,7,8,9,10,11,11b-dodecahydrocyclohepta[a]naphthalen-3-yl]butan-2-one (PubChem CID 155751320) has the molecular formula C25H44O and a molecular weight of 360.63 g/mol. Its IUPAC name is 3-[(6aR)-4-ethyl-3,6a,8,11a-tetramethyl-1,2,4,4a,5,6,7,8,9,10,11,11b-dodecahydrocyclohepta[a]naphthalen-3-yl]butan-2-one.
| Compound Name | 3-[(6aR)-4-ethyl-3,6a,8,11a-tetramethyl-1,2,4,4a,5,6,7,8,9,10,11,11b-dodecahydrocyclohepta[a]naphthalen-3-yl]butan-2-one |
|---|---|
| PubChem CID | 155751320 |
| Molecular Formula | C25H44O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | 3-[(6aR)-4-ethyl-3,6a,8,11a-tetramethyl-1,2,4,4a,5,6,7,8,9,10,11,11b-dodecahydrocyclohepta[a]naphthalen-3-yl]butan-2-one |
| SMILES | CCC1C2CC[C@]3(C)CC(C)CCCC3(C)C2CCC1(C)C(C)C(C)=O |
| InChI | InChI=1S/C25H44O/c1-8-21-20-11-14-23(5)16-17(2)10-9-13-25(23,7)22(20)12-15-24(21,6)18(3)19(4)26/h17-18,20-22H,8-16H2,1-7H3/t17?,18?,20?,21?,22?,23-,24?,25?/m1/s1 |
| InChIKey | QUXJNFXIYAIIGX-VNMILRJGSA-N |
| XLogP | 7.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |