C28H44N2O6 — CID 155751323
ethyl 2-[(5R)-17-(2-ethoxy-2-oxoethanimidoyl)-3,17-dihydroxy-5,10,13-trimethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]-2-iminoacetate (PubChem CID 155751323) has the molecular formula C28H44N2O6 and a molecular weight of 504.67 g/mol. Its IUPAC name is ethyl 2-[(5R)-17-(2-ethoxy-2-oxoethanimidoyl)-3,17-dihydroxy-5,10,13-trimethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]-2-iminoacetate.
| Compound Name | ethyl 2-[(5R)-17-(2-ethoxy-2-oxoethanimidoyl)-3,17-dihydroxy-5,10,13-trimethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]-2-iminoacetate |
|---|---|
| PubChem CID | 155751323 |
| Molecular Formula | C28H44N2O6 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | ethyl 2-[(5R)-17-(2-ethoxy-2-oxoethanimidoyl)-3,17-dihydroxy-5,10,13-trimethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]-2-iminoacetate |
| SMILES | [H]/N=C(\C(=O)OCC)C1(O)CCC2(C)C3CCC4(C)C(CCC4(O)/C(=N/[H])C(=O)OCC)C3CC[C@]2(C)C1 |
| InChI | InChI=1S/C28H44N2O6/c1-6-35-22(31)20(29)27(33)15-14-25(4)18-9-12-26(5)19(17(18)8-11-24(25,3)16-27)10-13-28(26,34)21(30)23(32)36-7-2/h17-19,29-30,33-34H,6-16H2,1-5H3/b29-20+,30-21+/t17?,18?,19?,24-,25?,26?,27?,28?/m1/s1 |
| InChIKey | KFTMRGRGKUPDLB-FRROOCFWSA-N |
| XLogP | 4.05 |
| TPSA | 140.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|