C26H40N4O4 — CID 167407585
ethyl 2-diazo-2-[(5S,8R,9S,10S,13S,14S)-3-(1-diazopropyl)-3,17-dihydroxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetate (PubChem CID 167407585) has the molecular formula C26H40N4O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is ethyl 2-diazo-2-[(5S,8R,9S,10S,13S,14S)-3-(1-diazopropyl)-3,17-dihydroxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetate.
| Compound Name | ethyl 2-diazo-2-[(5S,8R,9S,10S,13S,14S)-3-(1-diazopropyl)-3,17-dihydroxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetate |
|---|---|
| PubChem CID | 167407585 |
| Molecular Formula | C26H40N4O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | ethyl 2-diazo-2-[(5S,8R,9S,10S,13S,14S)-3-(1-diazopropyl)-3,17-dihydroxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetate |
| SMILES | CCOC(=O)C(=[N+]=[N-])C1(O)CC[C@H]2[C@@H]3CC[C@H]4CC(O)(C(CC)=[N+]=[N-])CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C26H40N4O4/c1-5-20(29-27)25(32)14-13-23(3)16(15-25)7-8-17-18(23)9-11-24(4)19(17)10-12-26(24,33)21(30-28)22(31)34-6-2/h16-19,32-33H,5-15H2,1-4H3/t16-,17+,18-,19-,23-,24-,25?,26?/m0/s1 |
| InChIKey | HLSPDMTVLXRXPU-LYNOHOORSA-N |
| XLogP | 3.81 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|